Главная / Полезные справочные материалы к ЕГЭ / Все сложные реакции заданий 32 из банка ФИПИ.

Все сложные реакции заданий 32 из банка ФИПИ.

Все реакции из заданий 32, которые могут вызвать затруднения при составлении. На ЕГЭ 99% реакций в заданиях 32 будут либо они, либо аналогичные.

1) Si + 2Cl2  SiCl4

2) SiCl4 + 3H2O H2SiO3 + 4HCl

3) Ca3(PO4)2 + 5C + 3SiO2  2P + 5CO + 3CaSiO3

4) Ca3N2 + 6H2O 3Ca(OH)2 + 2NH3

5) 2NH3 + 3CuO  3Cu + 3H2O + N2

6) Cu + 4HNO3(конц.) Cu(NO3)2 + 2NO2↑ + 2H2O

7) 2Cu(NO3)2  2CuO + 4NO2 + O2

8) 4FeS + 7O2  2Fe2O3 + 4SO2

9) 2H2S + SO2 3S↓ + 2H2O

10) S + 6HNO3  H2SO4 + 6NO2↑ + 2H2O

11) 4Al(NO3)3  2Al2O3 + 12NO2↑ + 3O2

12) 2Al2O3 4Al + 3O2↑ (электролиз раствора Al2O3 в расплаве криолита)

13) 3KNO3 + 8Al + 5KOH + 18H2O  3NH3↑ + 8K[Al(OH)4]

14) CrO3 + 2KOH K2CrO4 + H2O

15) 2K2CrO4 + H2SO4 K2Cr2O7 + K2SO4 + H2O

16) 14HBr + K2Cr2O7 2CrBr3 + 3Br2 + 7H2O + 2KBr

17) H2S + Br2 S↓ + 2HBr

18) 3Mg + N2  Mg3N2

19) Mg3N2 + 6H2O 3Mg(OH)2↓ + 2NH3

20) Cr2(SO4)3 + 6NH3 + 6H2O 2Cr(OH)3↓ + 3(NH4)2SO4

21) 2Cr(OH)3 + 4KOH + 3H2O2 2K2CrO4 + 8H2O

22) 2Ag + 2H2SO4(конц.) Ag2SO4 + SO2↑ + 2H2O

23) 2KClO3  2KCl + 3O2↑ (в присутствии кат-ра)

24) 3Fe + 2O2   Fe3O4

25) Fe3O4 + 8HCl FeCl2 + 2FeCl3 + 4H2O

26) 6FeCl2 + 14HCl + K2Cr2O7 6FeCl3 + 2CrCl3 + 2KCl + 7H2O

27) 2Na + H2 2NaH

28)  NaH + H2O NaOH + H2

29) 2NO2 + 2NaOH NaNO2 + NaNO3 + H2O

30) 2Al + 2NaOH + 6H2O 2Na[Al(OH)4] + 3H2

31) Cu + 2H2SO4   CuSO4 + SO2↑ + 2H2O

32) 2CuSO4 + 4KI 2CuI↓ + I2↓ + 2K2SO4

33) 2NaCl + 2H2O H2↑ + Cl2↑ + 2NaOH (электролиз раствора)

34) Fe2O3 + 6HI 2FeI2 + I2↓ + 3H2O

35) Na[Al(OH)4]  + CO2 NaHCO3 + Al(OH)3

36) Al2O3 + Na2CO3 (тв.) 2NaAlO2 + CO2↑ (сплавление)

37) Al4C3 + 12HBr 4AlBr3 + 3CH4

38) 2AlBr3 + 3K2SO3 + 3H2O 2Al(OH)3↓ + 3SO2↑ + 6KBr

39) 3SO2 + K2Cr2O7 + H2SO4 K2SO4 + Cr2(SO4)3 + H2O

40) Zn + 2KOH + 2H2O K2[Zn(OH)4] + H2

41) K2[Zn(OH)4]  K2ZnO2 + 2H2O

42) K2ZnO2 + 4HCl 2KCl + ZnCl2 + 2H2O

43) HI + KHCO3 KI + H2O + CO2

44) 6KI + K2Cr2O7 + 7H2SO4 4K2SO4 + 3I2↓ + Cr2(SO4)3 + 7H2O

45) 2AlI3 + 3Na2S + 6H2O 2Al(OH)3↓ + 3H2S↑ + 6NaI

46) Fe3O4 + 10HNO3 3Fe(NO3)3 + NO2↑ + 5H2O

47) Fe2O3 + Fe  3FeO

48) 2Na + O2 Na2O2 (горение)

49)  Na2O2 + 4HCl 2NaCl + 2H2O + Cl2

50) 3Cl2 + 10KOH + Cr2O3  2K2CrO4 + 6KCl + 5H2O

51) K2CrO4 + BaCl2 BaCrO4↓ + 2KCl

52) 2Cu(NO3)2 + 2H2O 2Cu + O2↑ + 4HNO3 (электролиз раствора)

53) 6 KOH + 3S K2SO3 + 2K2S + 3H2O

54) 6 KHCO3 + Fe2(SO4)3 2Fe(OH)3↓ + 3K2SO4 + 6CO2

55) KH + H2O KOH + H2

56) K2ZnO2 + 2H2SO4 K2SO4 + ZnSO4 + 2H2O

57) FeSO4 + 2NH3 + 2H2O Fe(OH)2↓ + (NH4)2SO4

58)  Fe(OH)2 + 4HNO3(конц.) Fe(NO3)3 + NO2↑ + 3H2O

59) 2Fe(NO3)3 + 3K2CO3 + 3H2O 2Fe(OH)3↓ + 3CO2↑ + 6KNO3

60) 4NO2 + 2Ca(OH)2 Ca(NO3)2 + Ca(NO2)2 + 2H2O

61) 3Ca + 2P Ca3P2

62) Ca3P2 + 6H2O 3Ca(OH)2 + 2PH3

63) PH3 + 8NaMnO4 + 11NaOH 8Na2MnO4 + Na3PO4 + 7H2O

64) Na2MnO4 + Na2SO3 + H2O MnO2↓ + Na2SO4 + 2NaOH

65) P + 5HNO3 H3PO4 + 5NO2↑ + H2O

66) 4Zn + 2NO2  4ZnO + N2

67) 2NaNO3   2NaNO2 + O2

68) NaNO2 + NH4I  NaI + N2↑ + 2H2O

69) 2NaI + H2O2 + H2SO4 Na2SO4 + I2↓ + 2H2O

70) 3I2 + 6NaOH(р−р)  NaIO3 + 5NaI + 3H2O

71) H2O2 + Ag2O 2Ag↓ + O2↑ + H2O

72) ZnS + 3O2  2ZnO + 2SO2

73) Na2[Zn(OH)4]  Na2ZnO2 + 2H2O

74) 3Cu2O + Na2Cr2O7 + 10H2SO4 6CuSO4 + Cr2(SO4)3 + Na2SO4 + 10H2O

75) NaHCO3 + NaOH Na2CO3 + H2O

76) K2Cr2O7(тв.) + 14HCl(конц.) 2CrCl3 + 2KCl + 3Cl2↑ + 7H2O

77) 3NaNO2 + 2KMnO4 + H2O 2MnO2↓ + 2KOH + 3NaNO3

78) MnO2 + 4HCl(конц.) MnCl2 + Cl2↑ + 2H2O

79) 2Fe(OH)3 + 6HI 2FeI2 + I2↓ + 6H2O

80) 3Na2CO3 + 2CrBr3 + 3H2O 2Cr(OH)3↓ + 6NaBr + 3CO2

81) 5FeCl2 + KMnO4 + 8HCl 5FeCl3 + MnCl2 + KCl + 4H2O

82) K2SiO3(рр) + 2H2O + 2CO2 H2SiO3↓ + 2KHCO3

83)  Ba(OH)2 + 2NaHCO3 Na2CO3 + BaCO3↓ + 2H2O

84) 6KOH + 3Cl2  KClO3 + 5KCl + 3H2O

85) Cr2O3 + KClO3 + 4KOH 2K2CrO4 + KCl + 2H2O

86) 4NH3 + 5O2 4NO + 6H2O (кат. Pt, Cr2O3, t, p)

87) 2NO + O2 2NO2

88) NaNO2 + 2KMnO4 + 2KOH 2K2MnO4 + NaNO3 + H2O

89) 8KI(тв.) + 9H2SO4(конц.) 8KHSO4 + 4I2↓ + H2S↑ + 4H2O

90) Al2O3 + 2NaOH + 3H2O 2Na[Al(OH)4]

91) Na[Al(OH)4] + 4HNO3 NaNO3 + Al(NO3)3 + 4H2O

92) 2Ca(OH)2 + 2NO2 + 3O2 2Ca(NO3)2 + 2H2O

93) K[Al(OH)4] + SO2 KHSO3 + Al(OH)3

94) 8KOH + PCl5 K3PO4 + 5KCl + 4H2O

95) 2KBr(тв) + 2H2SO4(конц., гор.) K2SO4 + Br2 + SO2↑ + 2H2O

96) 3Br2 + 6KOH 5KBr + KBrO3 + 3H2O

97) Br2 + K2SO3 + 2NaOH 2NaBr + K2SO4 + H2O

98) Fe2O3 + 6HI 2FeI2 + I2 + 3H2O

99) Fe2O3 + 2NaOH(тв.) 2NaFeO2 + H2O (сплавление)

100) 4NO2 + O2 + 2H2O 4HNO3

101) NaFeO2 + 4HNO3(изб.) NaNO3 + Fe(NO3)3 + 2H2O

102) FeO + 4HNO3(конц.) Fe(NO3)3 + NO2↑ + 2H2O

103) Ca2Si + 4H2O 2Ca(OH)2 + SiH4

104) 3Na2SO3 + Na2Cr2O7 + 4H2SO4 Cr2(SO4)3 + 4Na2SO4 + 4H2O

105) 4Mg + 5H2SO4(конц.) 4MgSO4 + H2S↑ + 4H2O

106) CuS + 8HNO3(конц.) CuSO4 + 8NO2↑ + 4H2O

107) 3Cu + 8HNO3(разб.) 3Cu(NO3)2 + 2NO↑ + 4H2O

108) 2Cu(NO3)2 + 2H2O 2Cu↓ + O2↑ + 4HNO3 (электролиз раствора)

109) Cu2O + 3H2SO4(конц.) 2CuSO4 + SO2↑ + 3H2O

110) 2NaI + 2NaMnO4 I2↓ + 2Na2MnO4 (в сильнощелочном растворе)

111) 2Na2O2 + 2CO2  2Na2CO3 + O2

комментариев 14
  1. Денис

    Огромная Вам благодарность!) Сам давно хотел их выписать, но вы сделали это гораздо лучше!

  2. Катя

    огромное Вам спасибо!

  3. Ольга Белых


  4. Фотя

    Огромное спасибоооо :3
    Действительно нужная вещь ☺️✨

  5. Екатерина

    Доброго времени суток! Спасибо Вам за такую ценную информацию (не нужно искать самой и выписывать )А это действительно ВСЕ реакции,которые могут попасться на ЕГЭ?

    • Сергей Широкопояс

      В ЕГЭ нет четкого списка реакций, которые могут быть. Есть наиболее часто встречающиеся типы реакций. Это значит что реакции могут быть те же самые, а могут быть аналогичные тем, что здесь представлены.

  6. Кирилл Мурченко

    Будут ли добавления к этим реакциям?

    • Сергей Широкопояс

      реакции прошлого года добавлены

  7. Александра Гаврилова

    У вас после 85 идет не 86, а 87.

    • Сергей Широкопояс

      спасибо, поправил

  8. Анна

    Вопрос по реакции 52
    2 Cu(NO3)2+2H2O=2Cu+O2+4HNO3
    это опечатка или там условия специфические?
    по всем правилам идет гидролиз , вторая ступень =Cu(OH)2+HNO3
    или нет?

    • Сергей Широкопояс

      Все верно, опечатки нет.
      Реакция идет при осуществлении электролиза водного раствора нитрата меди. Добавил уточнение рядом с уравнением реакции

  9. Катя

    блин почему невозможно это распечатать ,шпору хотела на егэ взять

  10. Jumiople

    огромное спасибо. выписала всё и стала чувствовать себя немного, но более подготовленной к егэ)

Добавить комментарий

Ваш e-mail не будет опубликован.