Главная / Полезные справочные материалы к ЕГЭ / Все сложные реакции заданий 32 из банка ФИПИ.

Все сложные реакции заданий 32 из банка ФИПИ.

Все реакции из заданий 32, которые могут вызвать затруднения при составлении. На ЕГЭ 99% реакций в заданиях 32 будут либо они, либо аналогичные.

1) Si + 2Cl2  SiCl4

2) SiCl4 + 3H2O H2SiO3 + 4HCl

3) Ca3(PO4)2 + 5C + 3SiO2  2P + 5CO + 3CaSiO3

4) Ca3N2 + 6H2O 3Ca(OH)2 + 2NH3

5) 2NH3 + 3CuO  3Cu + 3H2O + N2

6) Cu + 4HNO3(конц.) Cu(NO3)2 + 2NO2↑ + 2H2O

7) 2Cu(NO3)2  2CuO + 4NO2 + O2

8) 4FeS + 7O2  2Fe2O3 + 4SO2

9) 2H2S + SO2 3S↓ + 2H2O

10) S + 6HNO3  H2SO4 + 6NO2↑ + 2H2O

11) 4Al(NO3)3  2Al2O3 + 12NO2↑ + 3O2

12) 2Al2O3 4Al + 3O2↑ (электролиз раствора Al2O3 в расплаве криолита)

13) 3KNO3 + 8Al + 5KOH + 18H2O  3NH3↑ + 8K[Al(OH)4]

14) CrO3 + 2KOH K2CrO4 + H2O

15) 2K2CrO4 + H2SO4 K2Cr2O7 + K2SO4 + H2O

16) 14HBr + K2Cr2O7 2CrBr3 + 3Br2 + 7H2O + 2KBr

17) H2S + Br2 S↓ + 2HBr

18) 3Mg + N2  Mg3N2

19) Mg3N2 + 6H2O 3Mg(OH)2↓ + 2NH3

20) Cr2(SO4)3 + 6NH3 + 6H2O 2Cr(OH)3↓ + 3(NH4)2SO4

21) 2Cr(OH)3 + 4KOH + 3H2O2 2K2CrO4 + 8H2O

22) 2Ag + 2H2SO4(конц.) Ag2SO4 + SO2↑ + 2H2O

23) 2KClO3  2KCl + 3O2↑ (в присутствии кат-ра)

24) 3Fe + 2O2   Fe3O4

25) Fe3O4 + 8HCl FeCl2 + 2FeCl3 + 4H2O

26) 6FeCl2 + 14HCl + K2Cr2O7 6FeCl3 + 2CrCl3 + 2KCl + 7H2O

27) 2Na + H2 2NaH

28)  NaH + H2O NaOH + H2

29) 2NO2 + 2NaOH NaNO2 + NaNO3 + H2O

30) 2Al + 2NaOH + 6H2O 2Na[Al(OH)4] + 3H2

31) Cu + 2H2SO4   CuSO4 + SO2↑ + 2H2O

32) 2CuSO4 + 4KI 2CuI↓ + I2↓ + 2K2SO4

33) 2NaCl + 2H2O H2↑ + Cl2↑ + 2NaOH (электролиз раствора)

34) Fe2O3 + 6HI 2FeI2 + I2↓ + 3H2O

35) Na[Al(OH)4]  + CO2 NaHCO3 + Al(OH)3

36) Al2O3 + Na2CO3 (тв.) 2NaAlO2 + CO2↑ (сплавление)

37) Al4C3 + 12HBr 4AlBr3 + 3CH4

38) 2AlBr3 + 3K2SO3 + 3H2O 2Al(OH)3↓ + 3SO2↑ + 6KBr

39) 3SO2 + K2Cr2O7 + H2SO4 K2SO4 + Cr2(SO4)3 + H2O

40) Zn + 2KOH + 2H2O K2[Zn(OH)4] + H2

41) K2[Zn(OH)4]  K2ZnO2 + 2H2O

42) K2ZnO2 + 4HCl 2KCl + ZnCl2 + 2H2O

43) HI + KHCO3 KI + H2O + CO2

44) 6KI + K2Cr2O7 + 7H2SO4 4K2SO4 + 3I2↓ + Cr2(SO4)3 + 7H2O

45) 2AlI3 + 3Na2S + 6H2O 2Al(OH)3↓ + 3H2S↑ + 6NaI

46) Fe3O4 + 10HNO3 3Fe(NO3)3 + NO2↑ + 5H2O

47) Fe2O3 + Fe  3FeO

48) 2Na + O2 Na2O2 (горение)

49)  Na2O2 + 4HCl 2NaCl + 2H2O + Cl2

50) 3Cl2 + 10KOH + Cr2O3  2K2CrO4 + 6KCl + 5H2O

51) K2CrO4 + BaCl2 BaCrO4↓ + 2KCl

52) 2Cu(NO3)2 + 2H2O 2Cu + O2↑ + 4HNO3 (электролиз раствора)

53) 6 KOH + 3S K2SO3 + 2K2S + 3H2O

54) 6 KHCO3 + Fe2(SO4)3 2Fe(OH)3↓ + 3K2SO4 + 6CO2

55) KH + H2O KOH + H2

56) K2ZnO2 + 2H2SO4 K2SO4 + ZnSO4 + 2H2O

57) FeSO4 + 2NH3 + 2H2O Fe(OH)2↓ + (NH4)2SO4

58)  Fe(OH)2 + 4HNO3(конц.) Fe(NO3)3 + NO2↑ + 3H2O

59) 2Fe(NO3)3 + 3K2CO3 + 3H2O 2Fe(OH)3↓ + 3CO2↑ + 6KNO3

60) 4NO2 + 2Ca(OH)2 Ca(NO3)2 + Ca(NO2)2 + 2H2O

61) 3Ca + 2P Ca3P2

62) Ca3P2 + 6H2O 3Ca(OH)2 + 2PH3

63) PH3 + 8NaMnO4 + 11NaOH 8Na2MnO4 + Na3PO4 + 7H2O

64) Na2MnO4 + Na2SO3 + H2O MnO2↓ + Na2SO4 + 2NaOH

65) P + 5HNO3 H3PO4 + 5NO2↑ + H2O

66) 4Zn + 2NO2  4ZnO + N2

67) 2NaNO3   2NaNO2 + O2

68) NaNO2 + NH4I  NaI + N2↑ + 2H2O

69) 2NaI + H2O2 + H2SO4 Na2SO4 + I2↓ + 2H2O

70) 3I2 + 6NaOH(р−р)  NaIO3 + 5NaI + 3H2O

71) H2O2 + Ag2O 2Ag↓ + O2↑ + H2O

72) ZnS + 3O2  2ZnO + 2SO2

73) Na2[Zn(OH)4]  Na2ZnO2 + 2H2O

74) 3Cu2O + Na2Cr2O7 + 10H2SO4 6CuSO4 + Cr2(SO4)3 + Na2SO4 + 10H2O

75) NaHCO3 + NaOH Na2CO3 + H2O

76) K2Cr2O7(тв.) + 14HCl(конц.) 2CrCl3 + 2KCl + 3Cl2↑ + 7H2O

77) 3NaNO2 + 2KMnO4 + H2O 2MnO2↓ + 2KOH + 3NaNO3

78) MnO2 + 4HCl(конц.) MnCl2 + Cl2↑ + 2H2O

79) 2Fe(OH)3 + 6HI 2FeI2 + I2↓ + 6H2O

80) 3Na2CO3 + 2CrBr3 + 3H2O 2Cr(OH)3↓ + 6NaBr + 3CO2

81) 5FeCl2 + KMnO4 + 8HCl 5FeCl3 + MnCl2 + KCl + 4H2O

82) K2SiO3(рр) + 2H2O + 2CO2 H2SiO3↓ + 2KHCO3

83)  Ba(OH)2 + 2NaHCO3 Na2CO3 + BaCO3↓ + 2H2O

84) 6KOH + 3Cl2  KClO3 + 5KCl + 3H2O

85) Cr2O3 + KClO3 + 4KOH 2K2CrO4 + KCl + 2H2O

86) 4NH3 + 5O2 4NO + 6H2O (кат. Pt, Cr2O3, t, p)

87) 2NO + O2 2NO2

88) NaNO2 + 2KMnO4 + 2KOH 2K2MnO4 + NaNO3 + H2O

89) 8KI(тв.) + 9H2SO4(конц.) 8KHSO4 + 4I2↓ + H2S↑ + 4H2O

90) Al2O3 + 2NaOH + 3H2O 2Na[Al(OH)4]

91) Na[Al(OH)4] + 4HNO3 NaNO3 + Al(NO3)3 + 4H2O

92) 2Ca(OH)2 + 2NO2 + 3O2 2Ca(NO3)2 + 2H2O

93) K[Al(OH)4] + SO2 KHSO3 + Al(OH)3

94) 8KOH + PCl5 K3PO4 + 5KCl + 4H2O

95) 2KBr(тв) + 2H2SO4(конц., гор.) K2SO4 + Br2 + SO2↑ + 2H2O

96) 3Br2 + 6KOH 5KBr + KBrO3 + 3H2O

97) Br2 + K2SO3 + 2NaOH 2NaBr + K2SO4 + H2O

98) Fe2O3 + 6HI 2FeI2 + I2 + 3H2O

99) Fe2O3 + 2NaOH(тв.) 2NaFeO2 + H2O (сплавление)

100) 4NO2 + O2 + 2H2O 4HNO3

101) NaFeO2 + 4HNO3(изб.) NaNO3 + Fe(NO3)3 + 2H2O

102) FeO + 4HNO3(конц.) Fe(NO3)3 + NO2↑ + 2H2O

103) Ca2Si + 4H2O 2Ca(OH)2 + SiH4

104) 3Na2SO3 + Na2Cr2O7 + 4H2SO4 Cr2(SO4)3 + 4Na2SO4 + 4H2O

105) 4Mg + 5H2SO4(конц.) 4MgSO4 + H2S↑ + 4H2O

106) CuS + 8HNO3(конц.) CuSO4 + 8NO2↑ + 4H2O

107) 3Cu + 8HNO3(разб.) 3Cu(NO3)2 + 2NO↑ + 4H2O

108) 2Cu(NO3)2 + 2H2O 2Cu↓ + O2↑ + 4HNO3 (электролиз раствора)

109) Cu2O + 3H2SO4(конц.) 2CuSO4 + SO2↑ + 3H2O

110) 2NaI + 2NaMnO4 I2↓ + 2Na2MnO4 (в сильнощелочном растворе)

111) 2Na2O2 + 2CO2  2Na2CO3 + O2

комментариев 16
  1. Денис

    Огромная Вам благодарность!) Сам давно хотел их выписать, но вы сделали это гораздо лучше!

  2. Катя

    огромное Вам спасибо!

  3. Ольга Белых

    Спасибо!!!

  4. Фотя

    Огромное спасибоооо :3
    Действительно нужная вещь ☺️✨

  5. Екатерина

    Доброго времени суток! Спасибо Вам за такую ценную информацию (не нужно искать самой и выписывать )А это действительно ВСЕ реакции,которые могут попасться на ЕГЭ?

    • Сергей Широкопояс

      В ЕГЭ нет четкого списка реакций, которые могут быть. Есть наиболее часто встречающиеся типы реакций. Это значит что реакции могут быть те же самые, а могут быть аналогичные тем, что здесь представлены.

  6. Кирилл Мурченко

    Будут ли добавления к этим реакциям?

    • Сергей Широкопояс

      реакции прошлого года добавлены

  7. Александра Гаврилова

    У вас после 85 идет не 86, а 87.

    • Сергей Широкопояс

      спасибо, поправил

  8. Анна

    Вопрос по реакции 52
    2 Cu(NO3)2+2H2O=2Cu+O2+4HNO3
    это опечатка или там условия специфические?
    по всем правилам идет гидролиз , вторая ступень =Cu(OH)2+HNO3
    или нет?

    • Сергей Широкопояс

      Все верно, опечатки нет.
      Реакция идет при осуществлении электролиза водного раствора нитрата меди. Добавил уточнение рядом с уравнением реакции

  9. Катя

    блин почему невозможно это распечатать ,шпору хотела на егэ взять

  10. Jumiople

    огромное спасибо. выписала всё и стала чувствовать себя немного, но более подготовленной к егэ)

  11. Самат

    почему не получается скопировать текст?

    • Сергей Широкопояс

      Потому что стоит защита от копирования. Извиняюсь за неудобство, но не знаю как иначе бороться с кражей материалов сторонними ресурсами. Если нужен список сложных реакций пишите в личку ВК

Добавить комментарий

Ваш e-mail не будет опубликован.